C18H26N8O6 — CID 130335113
[(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] pyrrolidine-1-carboxylate (PubChem CID 130335113) has the molecular formula C18H26N8O6 and a molecular weight of 450.46 g/mol. Its IUPAC name is [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] pyrrolidine-1-carboxylate.
| Compound Name | [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130335113 |
| Molecular Formula | C18H26N8O6 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] pyrrolidine-1-carboxylate |
| SMILES | NC1=N[C@H]2C(CN3C(=O)CCC3=O)N=C(N)N3CC(OC(=O)N4CCCC4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C18H26N8O6/c19-14-22-13-9(7-25-11(27)3-4-12(25)28)21-15(20)26-8-10(18(30,31)17(13,26)23-14)32-16(29)24-5-1-2-6-24/h9-10,13,30-31H,1-8H2,(H2,20,21)(H3,19,22,23)/t9?,10?,13-,17-/m0/s1 |
| InChIKey | YIOLAPGNNPPWPY-GGHSUZRVSA-N |
| XLogP | -3.59 |
| TPSA | 199.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|