C22H28N8O5 — CID 130344221
N-[(4S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-ethylbenzamide (PubChem CID 130344221) has the molecular formula C22H28N8O5 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[(4S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-ethylbenzamide.
| Compound Name | N-[(4S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-ethylbenzamide |
|---|---|
| PubChem CID | 130344221 |
| Molecular Formula | C22H28N8O5 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[(4S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-ethylbenzamide |
| SMILES | CCc1cccc(C(=O)NC2CN3C(N)=N[C@@H](CN4C(=O)CCC4=O)C4N=C(N)N[C@]43C2(O)O)c1 |
| InChI | InChI=1S/C22H28N8O5/c1-2-11-4-3-5-12(8-11)18(33)26-14-10-30-20(24)25-13(9-29-15(31)6-7-16(29)32)17-21(30,22(14,34)35)28-19(23)27-17/h3-5,8,13-14,17,34-35H,2,6-7,9-10H2,1H3,(H2,24,25)(H,26,33)(H3,23,27,28)/t13-,14?,17?,21+/m0/s1 |
| InChIKey | PTNJCSMQSBNPGH-DUDQDBTASA-N |
| XLogP | -2.83 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|