C23H27F3N8O5 — CID 130344138
N-[(4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 130344138) has the molecular formula C23H27F3N8O5 and a molecular weight of 552.51 g/mol. Its IUPAC name is N-[(4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[(4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 130344138 |
| Molecular Formula | C23H27F3N8O5 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-[(4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)CCc4cccc(C(F)(F)F)c4)C(O)(O)C23N1 |
| InChI | InChI=1S/C23H27F3N8O5/c24-23(25,26)12-3-1-2-11(8-12)4-5-15(35)30-14-10-34-20(28)29-13(9-33-16(36)6-7-17(33)37)18-21(34,22(14,38)39)32-19(27)31-18/h1-3,8,13-14,18,38-39H,4-7,9-10H2,(H2,28,29)(H,30,35)(H3,27,31,32)/t13-,14?,18?,21?/m0/s1 |
| InChIKey | ZNXOYMOKRGKEFY-IBTCXKBTSA-N |
| XLogP | -2.05 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|