C27H28N8O5 — CID 130335147
N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide (PubChem CID 130335147) has the molecular formula C27H28N8O5 and a molecular weight of 544.57 g/mol. Its IUPAC name is N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide.
| Compound Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 130335147 |
| Molecular Formula | C27H28N8O5 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](NC(=O)c4cccc5c4Cc4ccccc4-5)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C27H28N8O5/c28-24-32-22-18(11-34-20(36)8-9-21(34)37)30-25(29)35-12-19(27(39,40)26(22,35)33-24)31-23(38)16-7-3-6-15-14-5-2-1-4-13(14)10-17(15)16/h1-7,18-19,22,39-40H,8-12H2,(H2,29,30)(H,31,38)(H3,28,32,33)/t18-,19-,22-,26-/m0/s1 |
| InChIKey | UERBXKMHAZOYPH-KNQURDJFSA-N |
| XLogP | -1.82 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|