C23H28N8O7 — CID 153469505
N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,2-dimethyl-1,3-benzodioxole-4-carboxamide (PubChem CID 153469505) has the molecular formula C23H28N8O7 and a molecular weight of 528.53 g/mol. Its IUPAC name is N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,2-dimethyl-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,2-dimethyl-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 153469505 |
| Molecular Formula | C23H28N8O7 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,2-dimethyl-1,3-benzodioxole-4-carboxamide |
| SMILES | CC1(C)Oc2cccc(C(=O)NC3CN4C(N)=N[C@@H](CN5C(=O)CCC5=O)C5N=C(N)NC54C3(O)O)c2O1 |
| InChI | InChI=1S/C23H28N8O7/c1-21(2)37-12-5-3-4-10(16(12)38-21)18(34)27-13-9-31-20(25)26-11(8-30-14(32)6-7-15(30)33)17-22(31,23(13,35)36)29-19(24)28-17/h3-5,11,13,17,35-36H,6-9H2,1-2H3,(H2,25,26)(H,27,34)(H3,24,28,29)/t11-,13?,17?,22?/m0/s1 |
| InChIKey | GEWAISAVNWVRKY-UCUCZLJFSA-N |
| XLogP | -2.88 |
| TPSA | 217.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|