C22H27N9O5 — CID 159291130
N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,3-dihydroindole-1-carboxamide (PubChem CID 159291130) has the molecular formula C22H27N9O5 and a molecular weight of 497.52 g/mol. Its IUPAC name is N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 159291130 |
| Molecular Formula | C22H27N9O5 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,3-dihydroindole-1-carboxamide |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)N4CCc5ccccc54)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C22H27N9O5/c23-18-27-17-12(9-30-15(32)5-6-16(30)33)25-19(24)31-10-14(22(35,36)21(17,31)28-18)26-20(34)29-8-7-11-3-1-2-4-13(11)29/h1-4,12,14,17,35-36H,5-10H2,(H2,24,25)(H,26,34)(H3,23,27,28)/t12-,14?,17-,21-/m0/s1 |
| InChIKey | MFTMWBRJPNQNKO-GTMPWENASA-N |
| XLogP | -3.05 |
| TPSA | 202.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|