C18H23F3N8O5 — CID 166717464
N-[(9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-1-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 166717464) has the molecular formula C18H23F3N8O5 and a molecular weight of 488.43 g/mol. Its IUPAC name is N-[(9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-1-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166717464 |
| Molecular Formula | C18H23F3N8O5 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[(9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | NC1=NC2C(CN3C(=O)CCC3=O)N=C(N)N3C[C@H](NC(=O)C4(C(F)(F)F)CC4)C(O)(O)C23N1 |
| InChI | InChI=1S/C18H23F3N8O5/c19-18(20,21)15(3-4-15)12(32)25-8-6-29-14(23)24-7(5-28-9(30)1-2-10(28)31)11-16(29,17(8,33)34)27-13(22)26-11/h7-8,11,33-34H,1-6H2,(H2,23,24)(H,25,32)(H3,22,26,27)/t7?,8-,11?,16?/m0/s1 |
| InChIKey | JXLHSFCJNUDCLK-LOSXYDQNSA-N |
| XLogP | -3.36 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|