C17H22N8O6 — CID 166717356
1-[[(3aS,4S,9S,10aS)-2,6-diamino-9-(2,5-dioxopyrrolidin-1-yl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 166717356) has the molecular formula C17H22N8O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9-(2,5-dioxopyrrolidin-1-yl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9-(2,5-dioxopyrrolidin-1-yl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166717356 |
| Molecular Formula | C17H22N8O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9-(2,5-dioxopyrrolidin-1-yl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](N4C(=O)CCC4=O)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C17H22N8O6/c18-14-21-13-7(5-23-9(26)1-2-10(23)27)20-15(19)24-6-8(17(30,31)16(13,24)22-14)25-11(28)3-4-12(25)29/h7-8,13,30-31H,1-6H2,(H2,19,20)(H3,18,21,22)/t7-,8-,13-,16-/m0/s1 |
| InChIKey | BAHZBBUNHNATNM-DDZCTPGTSA-N |
| XLogP | -4.67 |
| TPSA | 207.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|