C16H19FN6O5 — CID 126501384
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-fluorobenzoate (PubChem CID 126501384) has the molecular formula C16H19FN6O5 and a molecular weight of 394.36 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-fluorobenzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 126501384 |
| Molecular Formula | C16H19FN6O5 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-fluorobenzoate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4ccc(F)cc4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C16H19FN6O5/c17-8-3-1-7(2-4-8)12(25)28-10-5-23-14(19)20-9(6-24)11-15(23,16(10,26)27)22-13(18)21-11/h1-4,9-11,24,26-27H,5-6H2,(H2,19,20)(H3,18,21,22)/t9-,10-,11-,15-/m0/s1 |
| InChIKey | SECJDXWDZKGKKG-VEABSNGSSA-N |
| XLogP | -2.98 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|