C17H22N6O5 — CID 126501424
[(3aS,4R)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate (PubChem CID 126501424) has the molecular formula C17H22N6O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(3aS,4R)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate.
| Compound Name | [(3aS,4R)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126501424 |
| Molecular Formula | C17H22N6O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(3aS,4R)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2CN3C(N)=N[C@@H](CO)C4N=C(N)NC43C2(O)O)cc1 |
| InChI | InChI=1S/C17H22N6O5/c1-8-2-4-9(5-3-8)13(25)28-11-6-23-15(19)20-10(7-24)12-16(23,17(11,26)27)22-14(18)21-12/h2-5,10-12,24,26-27H,6-7H2,1H3,(H2,19,20)(H3,18,21,22)/t10-,11?,12?,16?/m0/s1 |
| InChIKey | WELZJJCQZIKGPP-MJMQAPBISA-N |
| XLogP | -2.81 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|