C19H25N5O5 — CID 126539327
[(3aS,4R,8S,9S,10aS)-6-amino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-2-methylidene-1,3,3a,4,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate (PubChem CID 126539327) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is [(3aS,4R,8S,9S,10aS)-6-amino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-2-methylidene-1,3,3a,4,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate.
| Compound Name | [(3aS,4R,8S,9S,10aS)-6-amino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-2-methylidene-1,3,3a,4,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126539327 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [(3aS,4R,8S,9S,10aS)-6-amino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-2-methylidene-1,3,3a,4,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] 4-methylbenzoate |
| SMILES | C=C1N[C@H]2[C@H](CO)N=C(N)N3[C@@H](C)[C@H](OC(=O)c4ccc(C)cc4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C19H25N5O5/c1-9-4-6-12(7-5-9)16(26)29-15-10(2)24-17(20)22-13(8-25)14-18(24,19(15,27)28)23-11(3)21-14/h4-7,10,13-15,21,23,25,27-28H,3,8H2,1-2H3,(H2,20,22)/t10-,13-,14-,15-,18-/m0/s1 |
| InChIKey | HNZUKTQGABCQQJ-HSJGEDEKSA-N |
| XLogP | -1.68 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|