C12H11N3O4 — CID 12774888
(3,5-dioxo-1,2,4-triazin-2-yl)methyl 4-methylbenzoate (PubChem CID 12774888) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is (3,5-dioxo-1,2,4-triazin-2-yl)methyl 4-methylbenzoate.
| Compound Name | (3,5-dioxo-1,2,4-triazin-2-yl)methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 12774888 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (3,5-dioxo-1,2,4-triazin-2-yl)methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCn2ncc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H11N3O4/c1-8-2-4-9(5-3-8)11(17)19-7-15-12(18)14-10(16)6-13-15/h2-6H,7H2,1H3,(H,14,16,18) |
| InChIKey | YEGNIDPRWDJSBN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |