C12H13N3O2 — CID 71849931
(2-methyl-1,2,4-triazol-3-yl)methyl 4-methylbenzoate (PubChem CID 71849931) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is (2-methyl-1,2,4-triazol-3-yl)methyl 4-methylbenzoate.
| Compound Name | (2-methyl-1,2,4-triazol-3-yl)methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 71849931 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (2-methyl-1,2,4-triazol-3-yl)methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2ncnn2C)cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-9-3-5-10(6-4-9)12(16)17-7-11-13-8-14-15(11)2/h3-6,8H,7H2,1-2H3 |
| InChIKey | CEXIEVPPSRNOJO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |