C11H19N7O4 — CID 126501415
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 126501415) has the molecular formula C11H19N7O4 and a molecular weight of 313.32 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 126501415 |
| Molecular Formula | C11H19N7O4 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | C[C@H]1CN2C(N)=N[C@@H](COC(N)=O)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C11H19N7O4/c1-4-2-18-8(13)15-5(3-22-9(14)19)6-10(18,11(4,20)21)17-7(12)16-6/h4-6,20-21H,2-3H2,1H3,(H2,13,15)(H2,14,19)(H3,12,16,17)/t4-,5-,6-,10-/m0/s1 |
| InChIKey | QTLZLQBWQWIJGS-DOOUUMROSA-N |
| XLogP | -3.61 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|