C12H21N7O5 — CID 118441794
[(3aS,4R,8S,10aS)-2,6-diamino-10,10-dihydroxy-8-(2-hydroxyethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 118441794) has the molecular formula C12H21N7O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is [(3aS,4R,8S,10aS)-2,6-diamino-10,10-dihydroxy-8-(2-hydroxyethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,8S,10aS)-2,6-diamino-10,10-dihydroxy-8-(2-hydroxyethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 118441794 |
| Molecular Formula | C12H21N7O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(3aS,4R,8S,10aS)-2,6-diamino-10,10-dihydroxy-8-(2-hydroxyethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@@H]1N=C(N)N2[C@@H](CCO)CC(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C12H21N7O5/c13-8-17-7-6(4-24-10(15)21)16-9(14)19-5(1-2-20)3-11(22,23)12(7,19)18-8/h5-7,20,22-23H,1-4H2,(H2,14,16)(H2,15,21)(H3,13,17,18)/t5-,6-,7-,12-/m0/s1 |
| InChIKey | OWOUAVBCECVYBK-JCDSGLBZSA-N |
| XLogP | -4.10 |
| TPSA | 205.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|