C10H18N6O3 — CID 126501422
(3aS,4R,8S,10aS)-2,6-diamino-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol (PubChem CID 126501422) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (3aS,4R,8S,10aS)-2,6-diamino-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol.
| Compound Name | (3aS,4R,8S,10aS)-2,6-diamino-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
|---|---|
| PubChem CID | 126501422 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3aS,4R,8S,10aS)-2,6-diamino-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
| SMILES | C[C@H]1CC(O)(O)[C@]23NC(N)=N[C@H]2[C@H](CO)N=C(N)N13 |
| InChI | InChI=1S/C10H18N6O3/c1-4-2-9(18,19)10-6(14-7(11)15-10)5(3-17)13-8(12)16(4)10/h4-6,17-19H,2-3H2,1H3,(H2,12,13)(H3,11,14,15)/t4-,5-,6-,10-/m0/s1 |
| InChIKey | UYHKZJCWSAAMON-DOOUUMROSA-N |
| XLogP | -3.57 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|