C16H29N7O4 — CID 118485963
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl N-hexylcarbamate (PubChem CID 118485963) has the molecular formula C16H29N7O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl N-hexylcarbamate.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl N-hexylcarbamate |
|---|---|
| PubChem CID | 118485963 |
| Molecular Formula | C16H29N7O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC[C@@H]1N=C(N)N2CCC(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C16H29N7O4/c1-2-3-4-5-7-19-14(24)27-9-10-11-16(22-12(17)21-11)15(25,26)6-8-23(16)13(18)20-10/h10-11,25-26H,2-9H2,1H3,(H2,18,20)(H,19,24)(H3,17,21,22)/t10-,11-,16-/m0/s1 |
| InChIKey | MUHOOHGHKINREU-MMPTUQATSA-N |
| XLogP | -1.64 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|