C10H19Cl2N7O5 — CID 137199647
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-5-oxido-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl]methyl carbamate;dihydrochloride (PubChem CID 137199647) has the molecular formula C10H19Cl2N7O5 and a molecular weight of 388.21 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-5-oxido-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl]methyl carbamate;dihydrochloride.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-5-oxido-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl]methyl carbamate;dihydrochloride |
|---|---|
| PubChem CID | 137199647 |
| Molecular Formula | C10H19Cl2N7O5 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-5-oxido-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl]methyl carbamate;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)OC[C@H]1[C@@H]2N=C(N)N[C@]23N(CCC3(O)O)C(N)=[N+]1[O-] |
| InChI | InChI=1S/C10H17N7O5.2ClH/c11-6-14-5-4(3-22-8(13)18)17(21)7(12)16-2-1-9(19,20)10(5,16)15-6;;/h4-5,19-20H,1-3,12H2,(H2,13,18)(H3,11,14,15);2*1H/t4-,5-,10-;;/m0../s1 |
| InChIKey | XFISNSRBUNQNGQ-UIPPETONSA-N |
| XLogP | -3.50 |
| TPSA | 198.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|