C14H19F6N7O9 — CID 135900254
[(3aS,4R,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 135900254) has the molecular formula C14H19F6N7O9 and a molecular weight of 543.33 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 135900254 |
| Molecular Formula | C14H19F6N7O9 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(=O)OC[C@@H]1N=C(N)N2C[C@H](O)C(O)(O)[C@@]23NC(N)=N[C@@H]13.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H17N7O5.2C2HF3O2/c11-6-15-5-3(2-22-8(13)19)14-7(12)17-1-4(18)10(20,21)9(5,17)16-6;2*3-2(4,5)1(6)7/h3-5,18,20-21H,1-2H2,(H2,12,14)(H2,13,19)(H3,11,15,16);2*(H,6,7)/t3-,4-,5-,9-;;/m0../s1 |
| InChIKey | OSWIYICLESIYDG-SXPQGTMESA-N |
| XLogP | -3.61 |
| TPSA | 279.64 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|