C10H17N7O8S — CID 124514755
[(3aR,4R,9R,10aS)-2,6-diamino-10,10-dihydroxy-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 124514755) has the molecular formula C10H17N7O8S and a molecular weight of 395.35 g/mol. Its IUPAC name is [(3aR,4R,9R,10aS)-2,6-diamino-10,10-dihydroxy-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(3aR,4R,9R,10aS)-2,6-diamino-10,10-dihydroxy-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 124514755 |
| Molecular Formula | C10H17N7O8S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [(3aR,4R,9R,10aS)-2,6-diamino-10,10-dihydroxy-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@@H]1N=C(N)N2C[C@@H](OS(=O)(=O)O)C(O)(O)[C@@]23NC(N)=N[C@H]13 |
| InChI | InChI=1S/C10H17N7O8S/c11-6-15-5-3(2-24-8(13)18)14-7(12)17-1-4(25-26(21,22)23)10(19,20)9(5,17)16-6/h3-5,19-20H,1-2H2,(H2,12,14)(H2,13,18)(H3,11,15,16)(H,21,22,23)/t3-,4+,5+,9-/m0/s1 |
| InChIKey | ARSXTTJGWGCRRR-JVJCOLAWSA-N |
| XLogP | -5.05 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|