C13H20N6O6 — CID 57353668
4-[[(3aS,4R)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxy]-4-oxobutanoic acid (PubChem CID 57353668) has the molecular formula C13H20N6O6 and a molecular weight of 356.34 g/mol. Its IUPAC name is 4-[[(3aS,4R)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aS,4R)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57353668 |
| Molecular Formula | C13H20N6O6 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[[(3aS,4R)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxy]-4-oxobutanoic acid |
| SMILES | NC1=NC2[C@H](COC(=O)CCC(=O)O)N=C(N)N3CCC(O)(O)C23N1 |
| InChI | InChI=1S/C13H20N6O6/c14-10-17-9-6(5-25-8(22)2-1-7(20)21)16-11(15)19-4-3-12(23,24)13(9,19)18-10/h6,9,23-24H,1-5H2,(H2,15,16)(H,20,21)(H3,14,17,18)/t6-,9?,13?/m0/s1 |
| InChIKey | YCGDRIMCDVWSLA-MLGTYFKZSA-N |
| XLogP | -3.54 |
| TPSA | 196.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|