C10H16N7O9S- — CID 102411282
1-[[(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-1,3a,4,8-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxy]-N-sulfomethanimidate (PubChem CID 102411282) has the molecular formula C10H16N7O9S- and a molecular weight of 410.35 g/mol. Its IUPAC name is 1-[[(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-1,3a,4,8-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxy]-N-sulfomethanimidate.
| Compound Name | 1-[[(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-1,3a,4,8-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxy]-N-sulfomethanimidate |
|---|---|
| PubChem CID | 102411282 |
| Molecular Formula | C10H16N7O9S- |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[[(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-1,3a,4,8-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxy]-N-sulfomethanimidate |
| SMILES | NC1=N[C@H]2[C@H](COC([O-])=NS(=O)(=O)O)N=C(N)N3CC(O)(O)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C10H17N7O9S/c11-5-14-4-3(1-26-7(18)16-27(23,24)25)13-6(12)17-2-8(19,20)10(21,22)9(4,17)15-5/h3-4,19-22H,1-2H2,(H2,12,13)(H,16,18)(H3,11,14,15)(H,23,24,25)/p-1/t3-,4-,9-/m0/s1 |
| InChIKey | GEQVLVSQKTUBFK-GWWBTZNMSA-M |
| XLogP | -7.12 |
| TPSA | 271.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | -7.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|