C13H23N7O5 — CID 155260867
[(4R,10S)-2,6-diamino-1,10-dihydroxy-8-(2-hydroxyethyl)-10-methyl-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 155260867) has the molecular formula C13H23N7O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is [(4R,10S)-2,6-diamino-1,10-dihydroxy-8-(2-hydroxyethyl)-10-methyl-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(4R,10S)-2,6-diamino-1,10-dihydroxy-8-(2-hydroxyethyl)-10-methyl-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 155260867 |
| Molecular Formula | C13H23N7O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [(4R,10S)-2,6-diamino-1,10-dihydroxy-8-(2-hydroxyethyl)-10-methyl-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | C[C@]1(O)CC(CCO)N2C(N)=N[C@@H](COC(N)=O)C3N=C(N)N(O)C321 |
| InChI | InChI=1S/C13H23N7O5/c1-12(23)4-6(2-3-21)19-9(14)17-7(5-25-11(16)22)8-13(12,19)20(24)10(15)18-8/h6-8,21,23-24H,2-5H2,1H3,(H2,14,17)(H2,15,18)(H2,16,22)/t6?,7-,8?,12-,13?/m0/s1 |
| InChIKey | OONXEIWCBXVLFH-KKPRZKPQSA-N |
| XLogP | -2.93 |
| TPSA | 196.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |