C17H21F2N6O4+ — CID 159992262
[(3aS,4S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-9-yl] 2,3-difluorobenzoate (PubChem CID 159992262) has the molecular formula C17H21F2N6O4+ and a molecular weight of 411.39 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-9-yl] 2,3-difluorobenzoate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-9-yl] 2,3-difluorobenzoate |
|---|---|
| PubChem CID | 159992262 |
| Molecular Formula | C17H21F2N6O4+ |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-9-yl] 2,3-difluorobenzoate |
| SMILES | CC[C@@H]1NC(N)=[N+]2C[C@H](OC(=O)c3cccc(F)c3F)C(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C17H20F2N6O4/c1-2-9-12-16(24-14(20)23-12)17(27,28)10(6-25(16)15(21)22-9)29-13(26)7-4-3-5-8(18)11(7)19/h3-5,9-10,12,27-28H,2,6H2,1H3,(H5,20,21,22,23,24)/p+1/t9-,10-,12-,16-/m0/s1 |
| InChIKey | FMDOLWSFURQXJE-ZZTKVPBPSA-O |
| XLogP | -2.12 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|