C21H25N8O7+ — CID 145288286
[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-benzoylcarbamate (PubChem CID 145288286) has the molecular formula C21H25N8O7+ and a molecular weight of 501.48 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-benzoylcarbamate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 145288286 |
| Molecular Formula | C21H25N8O7+ |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-benzoylcarbamate |
| SMILES | NC1=N[C@@H](CN2C(=O)CCC2=O)[C@@H]2[NH+]=C(N)N[C@]23N1C[C@H](OC(=O)NC(=O)c1ccccc1)C3(O)O |
| InChI | InChI=1S/C21H24N8O7/c22-17-25-15-11(8-28-13(30)6-7-14(28)31)24-18(23)29-9-12(21(34,35)20(15,29)27-17)36-19(33)26-16(32)10-4-2-1-3-5-10/h1-5,11-12,15,34-35H,6-9H2,(H2,23,24)(H3,22,25,27)(H,26,32,33)/p+1/t11-,12-,15-,20-/m0/s1 |
| InChIKey | PSAQXDGDDRQAKN-CFOBNSSQSA-O |
| XLogP | -5.17 |
| TPSA | 226.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|