C22H26F3N8O6+ — CID 152890313
[(3aS,9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-[[3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 152890313) has the molecular formula C22H26F3N8O6+ and a molecular weight of 555.49 g/mol. Its IUPAC name is [(3aS,9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-[[3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | [(3aS,9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 152890313 |
| Molecular Formula | C22H26F3N8O6+ |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | [(3aS,9S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | NC1=NC(CN2C(=O)CCC2=O)C2[NH+]=C(N)NC23N1C[C@H](OC(=O)NCc1cccc(C(F)(F)F)c1)C3(O)O |
| InChI | InChI=1S/C22H25F3N8O6/c23-22(24,25)11-3-1-2-10(6-11)7-28-19(36)39-13-9-33-18(27)29-12(8-32-14(34)4-5-15(32)35)16-20(33,21(13,37)38)31-17(26)30-16/h1-3,6,12-13,16,37-38H,4-5,7-9H2,(H2,27,29)(H,28,36)(H3,26,30,31)/p+1/t12?,13-,16?,20?/m0/s1 |
| InChIKey | UDICUHFHBRKLST-XKKNEPRRSA-O |
| XLogP | -3.79 |
| TPSA | 209.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|