C20H23F3N7O7S+ — CID 140804483
[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 140804483) has the molecular formula C20H23F3N7O7S+ and a molecular weight of 562.51 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 140804483 |
| Molecular Formula | C20H23F3N7O7S+ |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | NC1=N[C@@H](CN2C(=O)CCC2=O)[C@@H]2[NH+]=C(N)N[C@]23N1C[C@H](OS(=O)(=O)c1cccc(C(F)(F)F)c1)C3(O)O |
| InChI | InChI=1S/C20H22F3N7O7S/c21-20(22,23)9-2-1-3-10(6-9)38(35,36)37-12-8-30-17(25)26-11(7-29-13(31)4-5-14(29)32)15-18(30,19(12,33)34)28-16(24)27-15/h1-3,6,11-12,15,33-34H,4-5,7-8H2,(H2,25,26)(H3,24,27,28)/p+1/t11-,12-,15-,18-/m0/s1 |
| InChIKey | LZEUZLIMNIOUTA-LLXPTAGJSA-O |
| XLogP | -4.31 |
| TPSA | 214.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|