C21H24F3N9O4 — CID 162609573
4-amino-N-[(10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-(trifluoromethyl)benzamide (PubChem CID 162609573) has the molecular formula C21H24F3N9O4 and a molecular weight of 523.48 g/mol. Its IUPAC name is 4-amino-N-[(10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N-[(10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162609573 |
| Molecular Formula | C21H24F3N9O4 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-amino-N-[(10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-(trifluoromethyl)benzamide |
| SMILES | NC1=NC2C(CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)c4ccc(N)c(C(F)(F)F)c4)[C@@H](O)C23N1 |
| InChI | InChI=1S/C21H24F3N9O4/c22-21(23,24)9-5-8(1-2-10(9)25)17(37)28-12-7-33-19(27)29-11(6-32-13(34)3-4-14(32)35)15-20(33,16(12)36)31-18(26)30-15/h1-2,5,11-12,15-16,36H,3-4,6-7,25H2,(H2,27,29)(H,28,37)(H3,26,30,31)/t11?,12?,15?,16-,20?/m1/s1 |
| InChIKey | VQHABCSOAFWGJN-UZXUJZPASA-N |
| XLogP | -2.11 |
| TPSA | 204.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|