C20H22Cl2N8O4 — CID 166717395
2,3-dichloro-N-[(4S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]benzamide (PubChem CID 166717395) has the molecular formula C20H22Cl2N8O4 and a molecular weight of 509.35 g/mol. Its IUPAC name is 2,3-dichloro-N-[(4S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[(4S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]benzamide |
|---|---|
| PubChem CID | 166717395 |
| Molecular Formula | C20H22Cl2N8O4 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2,3-dichloro-N-[(4S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]benzamide |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)c4cccc(Cl)c4Cl)[C@@H](O)C23N1 |
| InChI | InChI=1S/C20H22Cl2N8O4/c21-9-3-1-2-8(14(9)22)17(34)25-11-7-30-19(24)26-10(6-29-12(31)4-5-13(29)32)15-20(30,16(11)33)28-18(23)27-15/h1-3,10-11,15-16,33H,4-7H2,(H2,24,26)(H,25,34)(H3,23,27,28)/t10-,11?,15?,16+,20?/m0/s1 |
| InChIKey | XKMKMEHJQZSJLZ-KMORZYEFSA-N |
| XLogP | -1.40 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|