C20H25N7O4 — CID 142446600
(10R)-2,6-diamino-10-hydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purine-4-carboxylic acid (PubChem CID 142446600) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is (10R)-2,6-diamino-10-hydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purine-4-carboxylic acid.
| Compound Name | (10R)-2,6-diamino-10-hydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purine-4-carboxylic acid |
|---|---|
| PubChem CID | 142446600 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (10R)-2,6-diamino-10-hydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purine-4-carboxylic acid |
| SMILES | NC1=NC2C(C(=O)O)N=C(N)N3CC(NC(=O)c4cccc5c4CCCC5)[C@@H](O)C23N1 |
| InChI | InChI=1S/C20H25N7O4/c21-18-25-14-13(17(30)31)24-19(22)27-8-12(15(28)20(14,27)26-18)23-16(29)11-7-3-5-9-4-1-2-6-10(9)11/h3,5,7,12-15,28H,1-2,4,6,8H2,(H2,22,24)(H,23,29)(H,30,31)(H3,21,25,26)/t12?,13?,14?,15-,20?/m1/s1 |
| InChIKey | BWSZQIPJTMYSSR-NSOUWEPUSA-N |
| XLogP | -1.90 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |