C26H28N8O4 — CID 145288238
N-[(4S,9S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-phenylbenzamide (PubChem CID 145288238) has the molecular formula C26H28N8O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is N-[(4S,9S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-phenylbenzamide.
| Compound Name | N-[(4S,9S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 145288238 |
| Molecular Formula | C26H28N8O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[(4S,9S,10R)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-3-phenylbenzamide |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](NC(=O)c4cccc(-c5ccccc5)c4)[C@@H](O)C23N1 |
| InChI | InChI=1S/C26H28N8O4/c27-24-31-21-17(12-33-19(35)9-10-20(33)36)30-25(28)34-13-18(22(37)26(21,34)32-24)29-23(38)16-8-4-7-15(11-16)14-5-2-1-3-6-14/h1-8,11,17-18,21-22,37H,9-10,12-13H2,(H2,28,30)(H,29,38)(H3,27,31,32)/t17-,18-,21?,22+,26?/m0/s1 |
| InChIKey | PXLADHJMXOGLAE-QJIINRDHSA-N |
| XLogP | -1.04 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|