C27H28N8O4 — CID 166717475
N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-4-carboxamide (PubChem CID 166717475) has the molecular formula C27H28N8O4 and a molecular weight of 528.57 g/mol. Its IUPAC name is N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-4-carboxamide.
| Compound Name | N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-4-carboxamide |
|---|---|
| PubChem CID | 166717475 |
| Molecular Formula | C27H28N8O4 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-4-carboxamide |
| SMILES | NC1=NC2C(CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)c4cccc5c4-c4ccccc4C5)C(O)C23N1 |
| InChI | InChI=1S/C27H28N8O4/c28-25-32-22-17(11-34-19(36)8-9-20(34)37)31-26(29)35-12-18(23(38)27(22,35)33-25)30-24(39)16-7-3-5-14-10-13-4-1-2-6-15(13)21(14)16/h1-7,17-18,22-23,38H,8-12H2,(H2,29,31)(H,30,39)(H3,28,32,33) |
| InChIKey | NGRLSCCLYZYEFO-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|