C32H31N9O4 — CID 166717467
N-[2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide (PubChem CID 166717467) has the molecular formula C32H31N9O4 and a molecular weight of 605.66 g/mol. Its IUPAC name is N-[2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide.
| Compound Name | N-[2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 166717467 |
| Molecular Formula | C32H31N9O4 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | N-[2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-10-hydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
| SMILES | NC1=NC2C(CN3C(=O)CN(c4ccccc4)C3=O)N=C(N)N3CC(NC(=O)c4cccc5c4Cc4ccccc4-5)C(O)C23N1 |
| InChI | InChI=1S/C32H31N9O4/c33-29-37-26-23(14-40-25(42)16-39(31(40)45)18-8-2-1-3-9-18)36-30(34)41-15-24(27(43)32(26,41)38-29)35-28(44)21-12-6-11-20-19-10-5-4-7-17(19)13-22(20)21/h1-12,23-24,26-27,43H,13-16H2,(H2,34,36)(H,35,44)(H3,33,37,38) |
| InChIKey | OLBZBCXRQMGWHF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 181.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|