C32H31N9O3 — CID 166717500
N-[(4S)-2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide (PubChem CID 166717500) has the molecular formula C32H31N9O3 and a molecular weight of 589.66 g/mol. Its IUPAC name is N-[(4S)-2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide.
| Compound Name | N-[(4S)-2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 166717500 |
| Molecular Formula | C32H31N9O3 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | N-[(4S)-2,6-diamino-4-[(2,5-dioxo-3-phenylimidazolidin-1-yl)methyl]-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl]-9H-fluorene-1-carboxamide |
| SMILES | NC1=NC2[C@H](CN3C(=O)CN(c4ccccc4)C3=O)N=C(N)N3CC(NC(=O)c4cccc5c4Cc4ccccc4-5)CC23N1 |
| InChI | InChI=1S/C32H31N9O3/c33-29-37-27-25(16-40-26(42)17-39(31(40)44)20-8-2-1-3-9-20)36-30(34)41-15-19(14-32(27,41)38-29)35-28(43)23-12-6-11-22-21-10-5-4-7-18(21)13-24(22)23/h1-12,19,25,27H,13-17H2,(H2,34,36)(H,35,43)(H3,33,37,38)/t19?,25-,27?,32?/m0/s1 |
| InChIKey | VWJBVOQUSZRCSF-SNWMHBQMSA-N |
| XLogP | 1.21 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|