C21H28N8O5 — CID 166855396
(9S)-2,6-diamino-10,10-dihydroxy-N-methoxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxamide (PubChem CID 166855396) has the molecular formula C21H28N8O5 and a molecular weight of 472.51 g/mol. Its IUPAC name is (9S)-2,6-diamino-10,10-dihydroxy-N-methoxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxamide.
| Compound Name | (9S)-2,6-diamino-10,10-dihydroxy-N-methoxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxamide |
|---|---|
| PubChem CID | 166855396 |
| Molecular Formula | C21H28N8O5 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (9S)-2,6-diamino-10,10-dihydroxy-N-methoxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxamide |
| SMILES | CONC(=O)C1N=C(N)N2C[C@H](NC(=O)c3cccc4c3CCCC4)C(O)(O)C23NC(N)=NC13 |
| InChI | InChI=1S/C21H28N8O5/c1-34-28-17(31)14-15-20(27-18(22)26-15)21(32,33)13(9-29(20)19(23)25-14)24-16(30)12-8-4-6-10-5-2-3-7-11(10)12/h4,6,8,13-15,32-33H,2-3,5,7,9H2,1H3,(H2,23,25)(H,24,30)(H,28,31)(H3,22,26,27)/t13-,14?,15?,20?/m0/s1 |
| InChIKey | ZVBPHGRERYCBDM-SIFYEQCOSA-N |
| XLogP | -2.98 |
| TPSA | 199.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|