C20H26N7O5+ — CID 153469339
(3aS,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-carboxylic acid (PubChem CID 153469339) has the molecular formula C20H26N7O5+ and a molecular weight of 444.47 g/mol. Its IUPAC name is (3aS,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-carboxylic acid.
| Compound Name | (3aS,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 153469339 |
| Molecular Formula | C20H26N7O5+ |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (3aS,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-carboxylic acid |
| SMILES | NC1=N[C@H]2C(C(=O)O)NC(N)=[N+]3C[C@H](NC(=O)c4cccc5c4CCCC5)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C20H25N7O5/c21-17-25-14-13(16(29)30)24-18(22)27-8-12(20(31,32)19(14,27)26-17)23-15(28)11-7-3-5-9-4-1-2-6-10(9)11/h3,5,7,12-14,31-32H,1-2,4,6,8H2,(H7,21,22,23,24,25,26,28,29,30)/p+1/t12-,13?,14-,19-/m0/s1 |
| InChIKey | UKTSUUWTDMWVDH-JINVZLEWSA-O |
| XLogP | -3.28 |
| TPSA | 198.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|