C22H11F4I4O9S- — CID 153471570
4-[5-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxybicyclo[2.2.1]heptane-2-carbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471570) has the molecular formula C22H11F4I4O9S- and a molecular weight of 1035.00 g/mol. Its IUPAC name is 4-[5-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxybicyclo[2.2.1]heptane-2-carbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[5-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxybicyclo[2.2.1]heptane-2-carbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471570 |
| Molecular Formula | C22H11F4I4O9S- |
| Molecular Weight | 1035.00 g/mol |
| Exact Mass | 1034.62 |
| IUPAC Name | 4-[5-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxybicyclo[2.2.1]heptane-2-carbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(O)c1c(I)c(I)c(I)c(I)c1C(=O)OC1CC2CC1CC2C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C22H12F4I4O9S/c23-10-12(25)19(40(35,36)37)13(26)11(24)18(10)39-21(33)6-2-5-1-4(6)3-7(5)38-22(34)9-8(20(31)32)14(27)16(29)17(30)15(9)28/h4-7H,1-3H2,(H,31,32)(H,35,36,37)/p-1 |
| InChIKey | VWAMJHHTEYNWQZ-UHFFFAOYSA-M |
| XLogP | 5.44 |
| TPSA | 147.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|