C14H6F4IO6S- — CID 153471621
2,3,5,6-tetrafluoro-4-(4-iodo-3-methoxybenzoyl)oxybenzenesulfonate (PubChem CID 153471621) has the molecular formula C14H6F4IO6S- and a molecular weight of 505.16 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(4-iodo-3-methoxybenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(4-iodo-3-methoxybenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471621 |
| Molecular Formula | C14H6F4IO6S- |
| Molecular Weight | 505.16 g/mol |
| Exact Mass | 504.89 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(4-iodo-3-methoxybenzoyl)oxybenzenesulfonate |
| SMILES | COc1cc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)ccc1I |
| InChI | InChI=1S/C14H7F4IO6S/c1-24-7-4-5(2-3-6(7)19)14(20)25-12-8(15)10(17)13(26(21,22)23)11(18)9(12)16/h2-4H,1H3,(H,21,22,23)/p-1 |
| InChIKey | KEDZYHMXDWZSFR-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|