C15H11F3O4 — CID 91730450
(4-methoxyphenyl) 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 91730450) has the molecular formula C15H11F3O4 and a molecular weight of 312.24 g/mol. Its IUPAC name is (4-methoxyphenyl) 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | (4-methoxyphenyl) 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 91730450 |
| Molecular Formula | C15H11F3O4 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (4-methoxyphenyl) 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1ccc(OC(=O)c2cc(F)c(F)c(OC)c2F)cc1 |
| InChI | InChI=1S/C15H11F3O4/c1-20-8-3-5-9(6-4-8)22-15(19)10-7-11(16)13(18)14(21-2)12(10)17/h3-7H,1-2H3 |
| InChIKey | XUOVIFLADDYXCT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|