About phenyl benzoate
phenyl benzoate (PubChem CID 7169) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is phenyl benzoate.
Molecular Properties
| Compound Name | phenyl benzoate |
| PubChem CID | 7169 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | phenyl benzoate |
| SMILES | O=C(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H |
| InChIKey | FCJSHPDYVMKCHI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl benzoate?
The IUPAC name of phenyl benzoate (CID 7169) is phenyl benzoate.
What is the SMILES notation for phenyl benzoate?
The canonical SMILES for phenyl benzoate is O=C(Oc1ccccc1)c1ccccc1.
What is the InChIKey of phenyl benzoate?
The InChIKey is FCJSHPDYVMKCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenyl benzoate?
phenyl benzoate has a molecular weight of 198.22 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl benzoate is sourced from PubChem (CID 7169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).