C45H30O — CID 153473424
2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran (PubChem CID 153473424) has the molecular formula C45H30O and a molecular weight of 594.78 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran.
| Compound Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 153473424 |
| Molecular Formula | C45H30O |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]naphtho[2,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4oc5cc6ccccc6cc5c4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2c1[2H] |
| InChI | InChI=1S/C45H30O/c1-45(2)39-18-10-9-13-31(39)32-21-19-30(25-40(32)45)44-35-16-7-5-14-33(35)43(34-15-6-8-17-36(34)44)29-20-22-41-37(24-29)38-23-27-11-3-4-12-28(27)26-42(38)46-41/h3-26H,1-2H3/i5D,6D,7D,8D,14D,15D,16D,17D |
| InChIKey | WISNLUZEXQMBGF-GXPGWNOSSA-N |
| XLogP | 12.69 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|