About 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol
5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol (PubChem CID 153475297) has the molecular formula C12H24O6
and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol.
Molecular Properties
| Compound Name | 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol |
| PubChem CID | 153475297 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol |
| SMILES | CCC1C(COCC(C)O)OC(OC)C(O)C1O |
| InChI | InChI=1S/C12H24O6/c1-4-8-9(6-17-5-7(2)13)18-12(16-3)11(15)10(8)14/h7-15H,4-6H2,1-3H3 |
| InChIKey | KATINRJYRXYQMJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol?
The IUPAC name of 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol (CID 153475297) is 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol.
What is the SMILES notation for 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol?
The canonical SMILES for 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol is CCC1C(COCC(C)O)OC(OC)C(O)C1O.
What is the InChIKey of 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol?
The InChIKey is KATINRJYRXYQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O6/c1-4-8-9(6-17-5-7(2)13)18-12(16-3)11(15)10(8)14/h7-15H,4-6H2,1-3H3.
What are the key properties of 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol?
5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol has a molecular weight of 264.32 g/mol, XLogP of -0.50, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-(2-hydroxypropoxymethyl)-2-methoxyoxane-3,4-diol is sourced from PubChem (CID 153475297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).