C53H51N3O — CID 153476646
2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylbutan-2-yl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol (PubChem CID 153476646) has the molecular formula C53H51N3O and a molecular weight of 751.04 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylbutan-2-yl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol.
| Compound Name | 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylbutan-2-yl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 153476646 |
| Molecular Formula | C53H51N3O |
| Molecular Weight | 751.04 g/mol |
| Exact Mass | 750.43 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylbutan-2-yl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccnc(-c3cc(-c4cccc5c4nc(-c4cc(C)cc(C)c4O)n5-c4ccc(C(C)(C)CC)cc4-c4ccccc4)cc(C(C)(C)C)c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H51N3O/c1-9-53(7,8)41-23-24-47(44(33-41)37-19-14-11-15-20-37)56-48-22-16-21-43(49(48)55-51(56)45-28-34(2)27-35(3)50(45)57)39-29-40(31-42(30-39)52(4,5)6)46-32-38(25-26-54-46)36-17-12-10-13-18-36/h10-33,57H,9H2,1-8H3/i10D,12D,13D,17D,18D |
| InChIKey | ILJHEIUNPOOSTD-PULSLKEDSA-N |
| XLogP | 14.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.04 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |