C52H49N3O — CID 153479622
2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylpropyl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol (PubChem CID 153479622) has the molecular formula C52H49N3O and a molecular weight of 737.01 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylpropyl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol.
| Compound Name | 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylpropyl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 153479622 |
| Molecular Formula | C52H49N3O |
| Molecular Weight | 737.01 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-[4-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridinyl]phenyl]-1-[4-(2-methylpropyl)-2-phenylphenyl]benzimidazol-2-yl]-4,6-dimethylphenol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccnc(-c3cc(-c4cccc5c4nc(-c4cc(C)cc(C)c4O)n5-c4ccc(CC(C)C)cc4-c4ccccc4)cc(C(C)(C)C)c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H49N3O/c1-33(2)25-36-21-22-47(44(28-36)38-17-12-9-13-18-38)55-48-20-14-19-43(49(48)54-51(55)45-27-34(3)26-35(4)50(45)56)40-29-41(31-42(30-40)52(5,6)7)46-32-39(23-24-53-46)37-15-10-8-11-16-37/h8-24,26-33,56H,25H2,1-7H3/i8D,10D,11D,15D,16D |
| InChIKey | QDPKCWMRVAUYGV-HNOVXVRVSA-N |
| XLogP | 13.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.01 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |