C33H35NO2S — CID 15347764
[(4R,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol (PubChem CID 15347764) has the molecular formula C33H35NO2S and a molecular weight of 509.72 g/mol. Its IUPAC name is [(4R,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol.
| Compound Name | [(4R,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol |
|---|---|
| PubChem CID | 15347764 |
| Molecular Formula | C33H35NO2S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | [(4R,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol |
| SMILES | CN(C)C(c1ccccc1)(c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1C(S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO2S/c1-31(2)35-29(32(34(3)4,25-17-9-5-10-18-25)26-19-11-6-12-20-26)30(36-31)33(37,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,29-30,37H,1-4H3/t29-,30-/m1/s1 |
| InChIKey | DXHZCZMGSRBNDC-LOYHVIPDSA-N |
| XLogP | 6.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|