C33H34ClNO2 — CID 15347763
1-[(4S,5R)-5-[chloro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-dimethyl-1,1-diphenylmethanamine (PubChem CID 15347763) has the molecular formula C33H34ClNO2 and a molecular weight of 512.09 g/mol. Its IUPAC name is 1-[(4S,5R)-5-[chloro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-dimethyl-1,1-diphenylmethanamine.
| Compound Name | 1-[(4S,5R)-5-[chloro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-dimethyl-1,1-diphenylmethanamine |
|---|---|
| PubChem CID | 15347763 |
| Molecular Formula | C33H34ClNO2 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 1-[(4S,5R)-5-[chloro(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-dimethyl-1,1-diphenylmethanamine |
| SMILES | CN(C)C(c1ccccc1)(c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1C(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34ClNO2/c1-31(2)36-29(32(34,25-17-9-5-10-18-25)26-19-11-6-12-20-26)30(37-31)33(35(3)4,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,29-30H,1-4H3/t29-,30-/m1/s1 |
| InChIKey | WJKYFWVLRKMKAB-LOYHVIPDSA-N |
| XLogP | 7.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|