C61H42N3OPt- — CID 153480660
2-[1-[2,5-diphenyl-4-(trideuteriomethyl)phenyl]-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153480660) has the molecular formula C61H42N3OPt- and a molecular weight of 1031.12 g/mol. Its IUPAC name is 2-[1-[2,5-diphenyl-4-(trideuteriomethyl)phenyl]-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-[2,5-diphenyl-4-(trideuteriomethyl)phenyl]-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153480660 |
| Molecular Formula | C61H42N3OPt- |
| Molecular Weight | 1031.12 g/mol |
| Exact Mass | 1030.32 |
| IUPAC Name | 2-[1-[2,5-diphenyl-4-(trideuteriomethyl)phenyl]-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | [2H]C([2H])([2H])c1cc(-c2ccccc2)c(-n2c(-c3ccccc3O)nc3c(-c4[c-]c(-c5cc(-c6ccc(-c7ccccc7)cc6)ccn5)cc(-c5ccccc5)c4)cccc32)cc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C61H42N3O.Pt/c1-41-35-55(47-23-12-5-13-24-47)58(40-54(41)46-21-10-4-11-22-46)64-57-27-16-26-52(60(57)63-61(64)53-25-14-15-28-59(53)65)50-36-49(43-19-8-3-9-20-43)37-51(38-50)56-39-48(33-34-62-56)45-31-29-44(30-32-45)42-17-6-2-7-18-42;/h2-37,39-40,65H,1H3;/q-1;/i1D3; |
| InChIKey | LIJNCUHVBZZJAK-NIIDSAIPSA-N |
| XLogP | 15.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.12 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|