C59H46N3OPt- — CID 153481711
2-[1-(4-tert-butyl-2,5-diphenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153481711) has the molecular formula C59H46N3OPt- and a molecular weight of 1008.12 g/mol. Its IUPAC name is 2-[1-(4-tert-butyl-2,5-diphenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-(4-tert-butyl-2,5-diphenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153481711 |
| Molecular Formula | C59H46N3OPt- |
| Molecular Weight | 1008.12 g/mol |
| Exact Mass | 1007.33 |
| IUPAC Name | 2-[1-(4-tert-butyl-2,5-diphenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | Cc1ccc(-c2ccnc(-c3[c-]c(-c4cccc5c4nc(-c4ccccc4O)n5-c4cc(-c5ccccc5)c(C(C)(C)C)cc4-c4ccccc4)cc(-c4ccccc4)c3)c2)cc1.[Pt] |
| InChI | InChI=1S/C59H46N3O.Pt/c1-39-27-29-41(30-28-39)44-31-32-60-53(36-44)47-34-45(40-17-8-5-9-18-40)33-46(35-47)48-24-16-25-54-57(48)61-58(49-23-14-15-26-56(49)63)62(54)55-38-50(42-19-10-6-11-20-42)52(59(2,3)4)37-51(55)43-21-12-7-13-22-43;/h5-34,36-38,63H,1-4H3;/q-1; |
| InChIKey | YANUBKJKQPLEIL-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.12 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|