C53H42N3OPt- — CID 153482657
2-[1-(3-tert-butyl-4-phenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153482657) has the molecular formula C53H42N3OPt- and a molecular weight of 932.02 g/mol. Its IUPAC name is 2-[1-(3-tert-butyl-4-phenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-(3-tert-butyl-4-phenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153482657 |
| Molecular Formula | C53H42N3OPt- |
| Molecular Weight | 932.02 g/mol |
| Exact Mass | 931.30 |
| IUPAC Name | 2-[1-(3-tert-butyl-4-phenylphenyl)-4-[3-[4-(4-methylphenyl)-2-pyridinyl]-5-phenylbenzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | Cc1ccc(-c2ccnc(-c3[c-]c(-c4cccc5c4nc(-c4ccccc4O)n5-c4ccc(-c5ccccc5)c(C(C)(C)C)c4)cc(-c4ccccc4)c3)c2)cc1.[Pt] |
| InChI | InChI=1S/C53H42N3O.Pt/c1-35-22-24-37(25-23-35)39-28-29-54-48(33-39)42-31-40(36-14-7-5-8-15-36)30-41(32-42)45-19-13-20-49-51(45)55-52(46-18-11-12-21-50(46)57)56(49)43-26-27-44(38-16-9-6-10-17-38)47(34-43)53(2,3)4;/h5-31,33-34,57H,1-4H3;/q-1; |
| InChIKey | UVDINCDSNVNZPM-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.02 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|