C51H38N3OPt- — CID 153476875
2-[1-[3-(2-deuteriopropan-2-yl)-4-phenylphenyl]-4-[3-phenyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153476875) has the molecular formula C51H38N3OPt- and a molecular weight of 904.97 g/mol. Its IUPAC name is 2-[1-[3-(2-deuteriopropan-2-yl)-4-phenylphenyl]-4-[3-phenyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-[3-(2-deuteriopropan-2-yl)-4-phenylphenyl]-4-[3-phenyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153476875 |
| Molecular Formula | C51H38N3OPt- |
| Molecular Weight | 904.97 g/mol |
| Exact Mass | 904.27 |
| IUPAC Name | 2-[1-[3-(2-deuteriopropan-2-yl)-4-phenylphenyl]-4-[3-phenyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | [2H]C(C)(C)c1cc(-n2c(-c3ccccc3O)nc3c(-c4[c-]c(-c5cc(-c6ccccc6)ccn5)cc(-c5ccccc5)c4)cccc32)ccc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C51H38N3O.Pt/c1-34(2)46-33-42(25-26-43(46)37-19-10-5-11-20-37)54-48-23-14-22-44(50(48)53-51(54)45-21-12-13-24-49(45)55)40-29-39(36-17-8-4-9-18-36)30-41(31-40)47-32-38(27-28-52-47)35-15-6-3-7-16-35;/h3-30,32-34,55H,1-2H3;/q-1;/i34D; |
| InChIKey | WCTWRVUUNIBEMC-ZOMAHUMBSA-N |
| XLogP | 13.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.97 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|